C12H20O3 — CID 22051876
1,2,3-tris[(E)-prop-1-enoxy]propane (PubChem CID 22051876) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1,2,3-tris[(E)-prop-1-enoxy]propane.
| Compound Name | 1,2,3-tris[(E)-prop-1-enoxy]propane |
|---|---|
| PubChem CID | 22051876 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 1,2,3-tris[(E)-prop-1-enoxy]propane |
| SMILES | C/C=C/OCC(CO/C=C/C)O/C=C/C |
| InChI | InChI=1S/C12H20O3/c1-4-7-13-10-12(15-9-6-3)11-14-8-5-2/h4-9,12H,10-11H2,1-3H3/b7-4+,8-5+,9-6+ |
| InChIKey | CGNGSILLCOCEJH-OTWDQPKHSA-N |
| XLogP | 3.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|