About 2-bromo-5-fluorofuran
2-bromo-5-fluorofuran (PubChem CID 22052020) has the molecular formula C4H2BrFO
and a molecular weight of 164.96 g/mol. Its IUPAC name is 2-bromo-5-fluorofuran.
Molecular Properties
| Compound Name | 2-bromo-5-fluorofuran |
| PubChem CID | 22052020 |
| Molecular Formula | C4H2BrFO |
| Molecular Weight | 164.96 g/mol |
| Exact Mass | 163.93 |
| IUPAC Name | 2-bromo-5-fluorofuran |
| SMILES | Fc1ccc(Br)o1 |
| InChI | InChI=1S/C4H2BrFO/c5-3-1-2-4(6)7-3/h1-2H |
| InChIKey | NSXRHJFVKQQLOJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.96 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-5-fluorofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-fluorofuran?
The IUPAC name of 2-bromo-5-fluorofuran (CID 22052020) is 2-bromo-5-fluorofuran.
What is the SMILES notation for 2-bromo-5-fluorofuran?
The canonical SMILES for 2-bromo-5-fluorofuran is Fc1ccc(Br)o1.
What is the InChIKey of 2-bromo-5-fluorofuran?
The InChIKey is NSXRHJFVKQQLOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrFO/c5-3-1-2-4(6)7-3/h1-2H.
What are the key properties of 2-bromo-5-fluorofuran?
2-bromo-5-fluorofuran has a molecular weight of 164.96 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-fluorofuran is sourced from PubChem (CID 22052020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).