C26H29ClN4O2 — CID 22052453
3-[2-(4-aminophenyl)ethoxy]-4-chloro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide (PubChem CID 22052453) has the molecular formula C26H29ClN4O2 and a molecular weight of 465.00 g/mol. Its IUPAC name is 3-[2-(4-aminophenyl)ethoxy]-4-chloro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide.
| Compound Name | 3-[2-(4-aminophenyl)ethoxy]-4-chloro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 22052453 |
| Molecular Formula | C26H29ClN4O2 |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 3-[2-(4-aminophenyl)ethoxy]-4-chloro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide |
| SMILES | Nc1ccc(CCOc2cc(C(=O)NCC3CCN(c4ccncc4)CC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C26H29ClN4O2/c27-24-6-3-21(17-25(24)33-16-11-19-1-4-22(28)5-2-19)26(32)30-18-20-9-14-31(15-10-20)23-7-12-29-13-8-23/h1-8,12-13,17,20H,9-11,14-16,18,28H2,(H,30,32) |
| InChIKey | CVUVHSMJDWAULJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|