About 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol
3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol (PubChem CID 22052678) has the molecular formula C36H30N2OS
and a molecular weight of 538.72 g/mol. Its IUPAC name is 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol.
Molecular Properties
| Compound Name | 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol |
| PubChem CID | 22052678 |
| Molecular Formula | C36H30N2OS |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol |
| SMILES | CCC1(CC)c2cc(-c3nc4ccccc4s3)ccc2-c2ccc(N(c3ccccc3)c3cccc(O)c3)cc21 |
| InChI | InChI=1S/C36H30N2OS/c1-3-36(4-2)31-21-24(35-37-33-15-8-9-16-34(33)40-35)17-19-29(31)30-20-18-27(23-32(30)36)38(25-11-6-5-7-12-25)26-13-10-14-28(39)22-26/h5-23,39H,3-4H2,1-2H3 |
| InChIKey | PGSXCUFTSXRYGH-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol?
The IUPAC name of 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol (CID 22052678) is 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol.
What is the SMILES notation for 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol?
The canonical SMILES for 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol is CCC1(CC)c2cc(-c3nc4ccccc4s3)ccc2-c2ccc(N(c3ccccc3)c3cccc(O)c3)cc21.
What is the InChIKey of 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol?
The InChIKey is PGSXCUFTSXRYGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H30N2OS/c1-3-36(4-2)31-21-24(35-37-33-15-8-9-16-34(33)40-35)17-19-29(31)30-20-18-27(23-32(30)36)38(25-11-6-5-7-12-25)26-13-10-14-28(39)22-26/h5-23,39H,3-4H2,1-2H3.
What are the key properties of 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol?
3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol has a molecular weight of 538.72 g/mol, XLogP of 10.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(N-[7-(1,3-benzothiazol-2-yl)-9,9-diethylfluoren-2-yl]anilino)phenol is sourced from PubChem (CID 22052678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).