About ruthenium(2+) dihexafluorophosphate
ruthenium(2+) dihexafluorophosphate (PubChem CID 22052995) has the molecular formula F12P2Ru
and a molecular weight of 390.99 g/mol. Its IUPAC name is ruthenium(2+) dihexafluorophosphate.
Molecular Properties
| Compound Name | ruthenium(2+) dihexafluorophosphate |
| PubChem CID | 22052995 |
| Molecular Formula | F12P2Ru |
| Molecular Weight | 390.99 g/mol |
| Exact Mass | 391.83 |
| IUPAC Name | ruthenium(2+) dihexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.[Ru+2] |
| InChI | InChI=1S/2F6P.Ru/c2*1-7(2,3,4,5)6;/q2*-1;+2 |
| InChIKey | UCTOQIYJZVHDHN-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.99 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ruthenium(2+) dihexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ruthenium(2+) dihexafluorophosphate?
The IUPAC name of ruthenium(2+) dihexafluorophosphate (CID 22052995) is ruthenium(2+) dihexafluorophosphate.
What is the SMILES notation for ruthenium(2+) dihexafluorophosphate?
The canonical SMILES for ruthenium(2+) dihexafluorophosphate is F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.[Ru+2].
What is the InChIKey of ruthenium(2+) dihexafluorophosphate?
The InChIKey is UCTOQIYJZVHDHN-UHFFFAOYSA-N. The full InChI is InChI=1S/2F6P.Ru/c2*1-7(2,3,4,5)6;/q2*-1;+2.
What are the key properties of ruthenium(2+) dihexafluorophosphate?
ruthenium(2+) dihexafluorophosphate has a molecular weight of 390.99 g/mol, XLogP of 6.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ruthenium(2+) dihexafluorophosphate is sourced from PubChem (CID 22052995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).