1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride

C5H11ClN2 — CID 22053582

IUPAC1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride
SMILESC[N+]1(C)C=NCC1.[Cl-]
InChIInChI=1S/C5H11N2.ClH/c1-7(2)4-3-6-5-7;/h5H,3-4H2,1-2H3;1H/q+1;/p-1
InChIKeyOZSNEDDDTVLMQN-UHFFFAOYSA-M
MW134.61 g/mol
LogP-2.89
Rot. Bonds

About 1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride

1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride (PubChem CID 22053582) has the molecular formula C5H11ClN2 and a molecular weight of 134.61 g/mol. Its IUPAC name is 1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride.

Molecular Properties

Compound Name1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride
PubChem CID22053582
Molecular FormulaC5H11ClN2
Molecular Weight134.61 g/mol
Exact Mass134.06
IUPAC Name1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride
SMILESC[N+]1(C)C=NCC1.[Cl-]
InChIInChI=1S/C5H11N2.ClH/c1-7(2)4-3-6-5-7;/h5H,3-4H2,1-2H3;1H/q+1;/p-1
InChIKeyOZSNEDDDTVLMQN-UHFFFAOYSA-M
XLogP-2.89
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.61
LogP ≤ 5-2.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride?
The IUPAC name of 1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride (CID 22053582) is 1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride.
What is the SMILES notation for 1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride?
The canonical SMILES for 1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride is C[N+]1(C)C=NCC1.[Cl-].
What is the InChIKey of 1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride?
The InChIKey is OZSNEDDDTVLMQN-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H11N2.ClH/c1-7(2)4-3-6-5-7;/h5H,3-4H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride?
1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride has a molecular weight of 134.61 g/mol, XLogP of -2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-4,5-dihydroimidazol-1-ium chloride is sourced from PubChem (CID 22053582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).