C12H13N3O2 — CID 22053938
2-amino-1-(3-phenyl-1,2,4-oxadiazol-5-yl)butan-1-one (PubChem CID 22053938) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-amino-1-(3-phenyl-1,2,4-oxadiazol-5-yl)butan-1-one.
| Compound Name | 2-amino-1-(3-phenyl-1,2,4-oxadiazol-5-yl)butan-1-one |
|---|---|
| PubChem CID | 22053938 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-amino-1-(3-phenyl-1,2,4-oxadiazol-5-yl)butan-1-one |
| SMILES | CCC(N)C(=O)c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C12H13N3O2/c1-2-9(13)10(16)12-14-11(15-17-12)8-6-4-3-5-7-8/h3-7,9H,2,13H2,1H3 |
| InChIKey | ZLYAIGMYJAYTAN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |