C14H22N2O2 — CID 22054431
2-[4-(4-aminobutyl)phenoxy]-N,N-dimethylacetamide (PubChem CID 22054431) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[4-(4-aminobutyl)phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(4-aminobutyl)phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 22054431 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-[4-(4-aminobutyl)phenoxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COc1ccc(CCCCN)cc1 |
| InChI | InChI=1S/C14H22N2O2/c1-16(2)14(17)11-18-13-8-6-12(7-9-13)5-3-4-10-15/h6-9H,3-5,10-11,15H2,1-2H3 |
| InChIKey | KNTMVDSFWNRERY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|