About 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine
1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine (PubChem CID 22054823) has the molecular formula C17H20F2N2O2
and a molecular weight of 322.36 g/mol. Its IUPAC name is 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine.
Molecular Properties
| Compound Name | 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine |
| PubChem CID | 22054823 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine |
| SMILES | COCOCC(N)C(N)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H20F2N2O2/c1-22-11-23-10-16(20)17(21,12-2-6-14(18)7-3-12)13-4-8-15(19)9-5-13/h2-9,16H,10-11,20-21H2,1H3 |
| InChIKey | OAKOQMHMIWMZGK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine?
The IUPAC name of 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine (CID 22054823) is 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine.
What is the SMILES notation for 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine?
The canonical SMILES for 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine is COCOCC(N)C(N)(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine?
The InChIKey is OAKOQMHMIWMZGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F2N2O2/c1-22-11-23-10-16(20)17(21,12-2-6-14(18)7-3-12)13-4-8-15(19)9-5-13/h2-9,16H,10-11,20-21H2,1H3.
What are the key properties of 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine?
1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine has a molecular weight of 322.36 g/mol, XLogP of 2.11, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(4-fluorophenyl)-3-(methoxymethoxy)propane-1,2-diamine is sourced from PubChem (CID 22054823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).