About 1,2,3-benzoxadiazol-3-ium
1,2,3-benzoxadiazol-3-ium (PubChem CID 22055061) has the molecular formula C6H5N2O+
and a molecular weight of 121.12 g/mol. Its IUPAC name is 1,2,3-benzoxadiazol-3-ium.
Molecular Properties
| Compound Name | 1,2,3-benzoxadiazol-3-ium |
| PubChem CID | 22055061 |
| Molecular Formula | C6H5N2O+ |
| Molecular Weight | 121.12 g/mol |
| Exact Mass | 121.04 |
| IUPAC Name | 1,2,3-benzoxadiazol-3-ium |
| SMILES | c1ccc2on[nH+]c2c1 |
| InChI | InChI=1S/C6H4N2O/c1-2-4-6-5(3-1)7-8-9-6/h1-4H/p+1 |
| InChIKey | SLLFVLKNXABYGI-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 40.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.12 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2,3-benzoxadiazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-benzoxadiazol-3-ium?
The IUPAC name of 1,2,3-benzoxadiazol-3-ium (CID 22055061) is 1,2,3-benzoxadiazol-3-ium.
What is the SMILES notation for 1,2,3-benzoxadiazol-3-ium?
The canonical SMILES for 1,2,3-benzoxadiazol-3-ium is c1ccc2on[nH+]c2c1.
What is the InChIKey of 1,2,3-benzoxadiazol-3-ium?
The InChIKey is SLLFVLKNXABYGI-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H4N2O/c1-2-4-6-5(3-1)7-8-9-6/h1-4H/p+1.
What are the key properties of 1,2,3-benzoxadiazol-3-ium?
1,2,3-benzoxadiazol-3-ium has a molecular weight of 121.12 g/mol, XLogP of 0.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-benzoxadiazol-3-ium is sourced from PubChem (CID 22055061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).