About 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane
2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane (PubChem CID 22055115) has the molecular formula C19H22O
and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane.
Molecular Properties
| Compound Name | 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane |
| PubChem CID | 22055115 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane |
| SMILES | Cc1cc(C)cc(-c2cc(C)c(CC3CO3)c(C)c2)c1 |
| InChI | InChI=1S/C19H22O/c1-12-5-13(2)7-16(6-12)17-8-14(3)19(15(4)9-17)10-18-11-20-18/h5-9,18H,10-11H2,1-4H3 |
| InChIKey | YPEMWXXNNODARV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane?
The IUPAC name of 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane (CID 22055115) is 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane.
What is the SMILES notation for 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane?
The canonical SMILES for 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane is Cc1cc(C)cc(-c2cc(C)c(CC3CO3)c(C)c2)c1.
What is the InChIKey of 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane?
The InChIKey is YPEMWXXNNODARV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O/c1-12-5-13(2)7-16(6-12)17-8-14(3)19(15(4)9-17)10-18-11-20-18/h5-9,18H,10-11H2,1-4H3.
What are the key properties of 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane?
2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane has a molecular weight of 266.38 g/mol, XLogP of 4.53, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]oxirane is sourced from PubChem (CID 22055115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).