About N-methylmethanamine;1,3,5-tripropyltriazinane
N-methylmethanamine;1,3,5-tripropyltriazinane (PubChem CID 22055173) has the molecular formula C14H34N4
and a molecular weight of 258.45 g/mol. Its IUPAC name is N-methylmethanamine;1,3,5-tripropyltriazinane.
Molecular Properties
| Compound Name | N-methylmethanamine;1,3,5-tripropyltriazinane |
| PubChem CID | 22055173 |
| Molecular Formula | C14H34N4 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.28 |
| IUPAC Name | N-methylmethanamine;1,3,5-tripropyltriazinane |
| SMILES | CCCC1CN(CCC)NN(CCC)C1.CNC |
| InChI | InChI=1S/C12H27N3.C2H7N/c1-4-7-12-10-14(8-5-2)13-15(11-12)9-6-3;1-3-2/h12-13H,4-11H2,1-3H3;3H,1-2H3 |
| InChIKey | HKYPTNGXKMZOIE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methylmethanamine;1,3,5-tripropyltriazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;1,3,5-tripropyltriazinane?
The IUPAC name of N-methylmethanamine;1,3,5-tripropyltriazinane (CID 22055173) is N-methylmethanamine;1,3,5-tripropyltriazinane.
What is the SMILES notation for N-methylmethanamine;1,3,5-tripropyltriazinane?
The canonical SMILES for N-methylmethanamine;1,3,5-tripropyltriazinane is CCCC1CN(CCC)NN(CCC)C1.CNC.
What is the InChIKey of N-methylmethanamine;1,3,5-tripropyltriazinane?
The InChIKey is HKYPTNGXKMZOIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N3.C2H7N/c1-4-7-12-10-14(8-5-2)13-15(11-12)9-6-3;1-3-2/h12-13H,4-11H2,1-3H3;3H,1-2H3.
What are the key properties of N-methylmethanamine;1,3,5-tripropyltriazinane?
N-methylmethanamine;1,3,5-tripropyltriazinane has a molecular weight of 258.45 g/mol, XLogP of 2.10, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;1,3,5-tripropyltriazinane is sourced from PubChem (CID 22055173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).