About 1,4-diacetylpiperazine-2,3-dione
1,4-diacetylpiperazine-2,3-dione (PubChem CID 22055230) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is 1,4-diacetylpiperazine-2,3-dione.
Molecular Properties
| Compound Name | 1,4-diacetylpiperazine-2,3-dione |
| PubChem CID | 22055230 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 1,4-diacetylpiperazine-2,3-dione |
| SMILES | CC(=O)N1CCN(C(C)=O)C(=O)C1=O |
| InChI | InChI=1S/C8H10N2O4/c1-5(11)9-3-4-10(6(2)12)8(14)7(9)13/h3-4H2,1-2H3 |
| InChIKey | PQTRERAGQHJMDN-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diacetylpiperazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diacetylpiperazine-2,3-dione?
The IUPAC name of 1,4-diacetylpiperazine-2,3-dione (CID 22055230) is 1,4-diacetylpiperazine-2,3-dione.
What is the SMILES notation for 1,4-diacetylpiperazine-2,3-dione?
The canonical SMILES for 1,4-diacetylpiperazine-2,3-dione is CC(=O)N1CCN(C(C)=O)C(=O)C1=O.
What is the InChIKey of 1,4-diacetylpiperazine-2,3-dione?
The InChIKey is PQTRERAGQHJMDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-5(11)9-3-4-10(6(2)12)8(14)7(9)13/h3-4H2,1-2H3.
What are the key properties of 1,4-diacetylpiperazine-2,3-dione?
1,4-diacetylpiperazine-2,3-dione has a molecular weight of 198.18 g/mol, XLogP of -1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diacetylpiperazine-2,3-dione is sourced from PubChem (CID 22055230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).