About ethanol;methanol;propan-2-one
ethanol;methanol;propan-2-one (PubChem CID 22056824) has the molecular formula C6H16O3
and a molecular weight of 136.19 g/mol. Its IUPAC name is ethanol;methanol;propan-2-one.
Molecular Properties
| Compound Name | ethanol;methanol;propan-2-one |
| PubChem CID | 22056824 |
| Molecular Formula | C6H16O3 |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.11 |
| IUPAC Name | ethanol;methanol;propan-2-one |
| SMILES | CC(C)=O.CCO.CO |
| InChI | InChI=1S/C3H6O.C2H6O.CH4O/c1-3(2)4;1-2-3;1-2/h1-2H3;3H,2H2,1H3;2H,1H3 |
| InChIKey | YJVCRVPZGVVAEQ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethanol;methanol;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;methanol;propan-2-one?
The IUPAC name of ethanol;methanol;propan-2-one (CID 22056824) is ethanol;methanol;propan-2-one.
What is the SMILES notation for ethanol;methanol;propan-2-one?
The canonical SMILES for ethanol;methanol;propan-2-one is CC(C)=O.CCO.CO.
What is the InChIKey of ethanol;methanol;propan-2-one?
The InChIKey is YJVCRVPZGVVAEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C2H6O.CH4O/c1-3(2)4;1-2-3;1-2/h1-2H3;3H,2H2,1H3;2H,1H3.
What are the key properties of ethanol;methanol;propan-2-one?
ethanol;methanol;propan-2-one has a molecular weight of 136.19 g/mol, XLogP of 0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;methanol;propan-2-one is sourced from PubChem (CID 22056824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).