About 1-O-ethyl 5-O-propyl pentanedioate
1-O-ethyl 5-O-propyl pentanedioate (PubChem CID 22057004) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-O-ethyl 5-O-propyl pentanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 5-O-propyl pentanedioate |
| PubChem CID | 22057004 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-O-ethyl 5-O-propyl pentanedioate |
| SMILES | CCCOC(=O)CCCC(=O)OCC |
| InChI | InChI=1S/C10H18O4/c1-3-8-14-10(12)7-5-6-9(11)13-4-2/h3-8H2,1-2H3 |
| InChIKey | WJINUXOOLPNQSV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-O-ethyl 5-O-propyl pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 5-O-propyl pentanedioate?
The IUPAC name of 1-O-ethyl 5-O-propyl pentanedioate (CID 22057004) is 1-O-ethyl 5-O-propyl pentanedioate.
What is the SMILES notation for 1-O-ethyl 5-O-propyl pentanedioate?
The canonical SMILES for 1-O-ethyl 5-O-propyl pentanedioate is CCCOC(=O)CCCC(=O)OCC.
What is the InChIKey of 1-O-ethyl 5-O-propyl pentanedioate?
The InChIKey is WJINUXOOLPNQSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-3-8-14-10(12)7-5-6-9(11)13-4-2/h3-8H2,1-2H3.
What are the key properties of 1-O-ethyl 5-O-propyl pentanedioate?
1-O-ethyl 5-O-propyl pentanedioate has a molecular weight of 202.25 g/mol, XLogP of 1.67, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 5-O-propyl pentanedioate is sourced from PubChem (CID 22057004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).