C45H47F9O12S2 — CID 22057123
diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;2,4,6-tris(trifluoromethyl)benzenesulfonate (PubChem CID 22057123) has the molecular formula C45H47F9O12S2 and a molecular weight of 1014.97 g/mol. Its IUPAC name is diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;2,4,6-tris(trifluoromethyl)benzenesulfonate.
| Compound Name | diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;2,4,6-tris(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22057123 |
| Molecular Formula | C45H47F9O12S2 |
| Molecular Weight | 1014.97 g/mol |
| Exact Mass | 1014.24 |
| IUPAC Name | diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;2,4,6-tris(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1cc(OCC(=O)OC(C)(C)C)c([S+](c2ccccc2)c2ccccc2)c(OCC(=O)OC(C)(C)C)c1.O=S(=O)([O-])c1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C36H45O9S.C9H3F9O3S/c1-34(2,3)43-30(37)22-40-25-20-28(41-23-31(38)44-35(4,5)6)33(29(21-25)42-24-32(39)45-36(7,8)9)46(26-16-12-10-13-17-26)27-18-14-11-15-19-27;10-7(11,12)3-1-4(8(13,14)15)6(22(19,20)21)5(2-3)9(16,17)18/h10-21H,22-24H2,1-9H3;1-2H,(H,19,20,21)/q+1;/p-1 |
| InChIKey | ZZBZSRWVDRMQTD-UHFFFAOYSA-M |
| XLogP | 10.59 |
| TPSA | 163.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.97 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|