C34H34F6O5S2 — CID 22057169
[2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;2,4-bis(trifluoromethyl)benzenesulfonate (PubChem CID 22057169) has the molecular formula C34H34F6O5S2 and a molecular weight of 700.76 g/mol. Its IUPAC name is [2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;2,4-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | [2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;2,4-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22057169 |
| Molecular Formula | C34H34F6O5S2 |
| Molecular Weight | 700.76 g/mol |
| Exact Mass | 700.18 |
| IUPAC Name | [2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;2,4-bis(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccccc2)c2ccccc2)c(OC(C)(C)C)c1.O=S(=O)([O-])c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C26H31O2S.C8H4F6O3S/c1-25(2,3)27-20-17-18-24(23(19-20)28-26(4,5)6)29(21-13-9-7-10-14-21)22-15-11-8-12-16-22;9-7(10,11)4-1-2-6(18(15,16)17)5(3-4)8(12,13)14/h7-19H,1-6H3;1-3H,(H,15,16,17)/q+1;/p-1 |
| InChIKey | HNCULKUEHJMUSV-UHFFFAOYSA-M |
| XLogP | 9.76 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.76 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|