C37H39F3O9S2 — CID 22057182
[2,4-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;4-(trifluoromethyl)benzenesulfonate (PubChem CID 22057182) has the molecular formula C37H39F3O9S2 and a molecular weight of 748.84 g/mol. Its IUPAC name is [2,4-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2,4-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22057182 |
| Molecular Formula | C37H39F3O9S2 |
| Molecular Weight | 748.84 g/mol |
| Exact Mass | 748.20 |
| IUPAC Name | [2,4-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;4-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1ccc([S+](c2ccccc2)c2ccccc2)c(OCC(=O)OC(C)(C)C)c1.O=S(=O)([O-])c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H35O6S.C7H5F3O3S/c1-29(2,3)35-27(31)20-33-22-17-18-26(25(19-22)34-21-28(32)36-30(4,5)6)37(23-13-9-7-10-14-23)24-15-11-8-12-16-24;8-7(9,10)5-1-3-6(4-2-5)14(11,12)13/h7-19H,20-21H2,1-6H3;1-4H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | METXPSOXIRBJDY-UHFFFAOYSA-M |
| XLogP | 7.83 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.84 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|