C43H49F3O12S2 — CID 22057191
diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;4-(trifluoromethyl)benzenesulfonate (PubChem CID 22057191) has the molecular formula C43H49F3O12S2 and a molecular weight of 878.98 g/mol. Its IUPAC name is diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;4-(trifluoromethyl)benzenesulfonate.
| Compound Name | diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22057191 |
| Molecular Formula | C43H49F3O12S2 |
| Molecular Weight | 878.98 g/mol |
| Exact Mass | 878.26 |
| IUPAC Name | diphenyl-[2,4,6-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;4-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1cc(OCC(=O)OC(C)(C)C)c([S+](c2ccccc2)c2ccccc2)c(OCC(=O)OC(C)(C)C)c1.O=S(=O)([O-])c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C36H45O9S.C7H5F3O3S/c1-34(2,3)43-30(37)22-40-25-20-28(41-23-31(38)44-35(4,5)6)33(29(21-25)42-24-32(39)45-36(7,8)9)46(26-16-12-10-13-17-26)27-18-14-11-15-19-27;8-7(9,10)5-1-3-6(4-2-5)14(11,12)13/h10-21H,22-24H2,1-9H3;1-4H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | YNWMARPAJYBECW-UHFFFAOYSA-M |
| XLogP | 8.55 |
| TPSA | 163.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.98 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|