C32H30F6O4S2 — CID 22057214
2,4-bis(trifluoromethyl)benzenesulfonate;[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium (PubChem CID 22057214) has the molecular formula C32H30F6O4S2 and a molecular weight of 656.71 g/mol. Its IUPAC name is 2,4-bis(trifluoromethyl)benzenesulfonate;[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium.
| Compound Name | 2,4-bis(trifluoromethyl)benzenesulfonate;[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 22057214 |
| Molecular Formula | C32H30F6O4S2 |
| Molecular Weight | 656.71 g/mol |
| Exact Mass | 656.15 |
| IUPAC Name | 2,4-bis(trifluoromethyl)benzenesulfonate;[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium |
| SMILES | Cc1cc(OC(C)(C)C)cc(C)c1[S+](c1ccccc1)c1ccccc1.O=S(=O)([O-])c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H27OS.C8H4F6O3S/c1-18-16-20(25-24(3,4)5)17-19(2)23(18)26(21-12-8-6-9-13-21)22-14-10-7-11-15-22;9-7(10,11)4-1-2-6(18(15,16)17)5(3-4)8(12,13)14/h6-17H,1-5H3;1-3H,(H,15,16,17)/q+1;/p-1 |
| InChIKey | LQULSBDFNKULFS-UHFFFAOYSA-M |
| XLogP | 9.20 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.71 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|