C41H35F15O9S2 — CID 22057301
[2,6-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate (PubChem CID 22057301) has the molecular formula C41H35F15O9S2 and a molecular weight of 1020.83 g/mol. Its IUPAC name is [2,6-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate.
| Compound Name | [2,6-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22057301 |
| Molecular Formula | C41H35F15O9S2 |
| Molecular Weight | 1020.83 g/mol |
| Exact Mass | 1020.15 |
| IUPAC Name | [2,6-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1cccc(OCC(=O)OC(C)(C)C)c1[S+](c1ccccc1)c1ccccc1.O=S(=O)([O-])c1c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C30H35O6S.C11HF15O3S/c1-29(2,3)35-26(31)20-33-24-18-13-19-25(34-21-27(32)36-30(4,5)6)28(24)37(22-14-9-7-10-15-22)23-16-11-8-12-17-23;12-7(13,14)1-2(8(15,16)17)4(10(21,22)23)6(30(27,28)29)5(11(24,25)26)3(1)9(18,19)20/h7-19H,20-21H2,1-6H3;(H,27,28,29)/q+1;/p-1 |
| InChIKey | IJANIOKJCRQJDG-UHFFFAOYSA-M |
| XLogP | 11.91 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.83 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|