C9H2F9O3S- — CID 22057315
2,4,6-tris(trifluoromethyl)benzenesulfonate (PubChem CID 22057315) has the molecular formula C9H2F9O3S- and a molecular weight of 361.16 g/mol. Its IUPAC name is 2,4,6-tris(trifluoromethyl)benzenesulfonate.
| Compound Name | 2,4,6-tris(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22057315 |
| Molecular Formula | C9H2F9O3S- |
| Molecular Weight | 361.16 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 2,4,6-tris(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H3F9O3S/c10-7(11,12)3-1-4(8(13,14)15)6(22(19,20)21)5(2-3)9(16,17)18/h1-2H,(H,19,20,21)/p-1 |
| InChIKey | JDUZZCHHGXEMNX-UHFFFAOYSA-M |
| XLogP | 3.65 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.16 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|