C41H39F15O6S2 — CID 22057379
diphenyl-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate (PubChem CID 22057379) has the molecular formula C41H39F15O6S2 and a molecular weight of 976.86 g/mol. Its IUPAC name is diphenyl-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate.
| Compound Name | diphenyl-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22057379 |
| Molecular Formula | C41H39F15O6S2 |
| Molecular Weight | 976.86 g/mol |
| Exact Mass | 976.19 |
| IUPAC Name | diphenyl-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)Oc1cc(OC(C)(C)C)c([S+](c2ccccc2)c2ccccc2)c(OC(C)(C)C)c1.O=S(=O)([O-])c1c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C30H39O3S.C11HF15O3S/c1-28(2,3)31-22-20-25(32-29(4,5)6)27(26(21-22)33-30(7,8)9)34(23-16-12-10-13-17-23)24-18-14-11-15-19-24;12-7(13,14)1-2(8(15,16)17)4(10(21,22)23)6(30(27,28)29)5(11(24,25)26)3(1)9(18,19)20/h10-21H,1-9H3;(H,27,28,29)/q+1;/p-1 |
| InChIKey | AHVOYEUFELPFSZ-UHFFFAOYSA-M |
| XLogP | 14.00 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.86 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|