About 4-hexyl-1,3-oxazolidin-2-one
4-hexyl-1,3-oxazolidin-2-one (PubChem CID 22057714) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-hexyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-hexyl-1,3-oxazolidin-2-one |
| PubChem CID | 22057714 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 4-hexyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCC1COC(=O)N1 |
| InChI | InChI=1S/C9H17NO2/c1-2-3-4-5-6-8-7-12-9(11)10-8/h8H,2-7H2,1H3,(H,10,11) |
| InChIKey | LIWFFLZDHLBKJB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexyl-1,3-oxazolidin-2-one?
The IUPAC name of 4-hexyl-1,3-oxazolidin-2-one (CID 22057714) is 4-hexyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-hexyl-1,3-oxazolidin-2-one?
The canonical SMILES for 4-hexyl-1,3-oxazolidin-2-one is CCCCCCC1COC(=O)N1.
What is the InChIKey of 4-hexyl-1,3-oxazolidin-2-one?
The InChIKey is LIWFFLZDHLBKJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-2-3-4-5-6-8-7-12-9(11)10-8/h8H,2-7H2,1H3,(H,10,11).
What are the key properties of 4-hexyl-1,3-oxazolidin-2-one?
4-hexyl-1,3-oxazolidin-2-one has a molecular weight of 171.24 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 22057714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).