About tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide
tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide (PubChem CID 22058921) has the molecular formula C56H48BO4P
and a molecular weight of 826.78 g/mol. Its IUPAC name is tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide.
Molecular Properties
| Compound Name | tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide |
| PubChem CID | 22058921 |
| Molecular Formula | C56H48BO4P |
| Molecular Weight | 826.78 g/mol |
| Exact Mass | 826.34 |
| IUPAC Name | tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide |
| SMILES | Cc1ccc(C(=O)[P+](C(=O)c2ccc(C)cc2)(C(=O)c2ccc(C)cc2)C(=O)c2ccc(C)cc2)cc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H28O4P.C24H20B/c1-21-5-13-25(14-6-21)29(33)37(30(34)26-15-7-22(2)8-16-26,31(35)27-17-9-23(3)10-18-27)32(36)28-19-11-24(4)12-20-28;1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h5-20H,1-4H3;1-20H/q+1;-1 |
| InChIKey | UNQQABCXUQNEKP-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 826.78 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide?
The IUPAC name of tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide (CID 22058921) is tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide.
What is the SMILES notation for tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide?
The canonical SMILES for tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide is Cc1ccc(C(=O)[P+](C(=O)c2ccc(C)cc2)(C(=O)c2ccc(C)cc2)C(=O)c2ccc(C)cc2)cc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide?
The InChIKey is UNQQABCXUQNEKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H28O4P.C24H20B/c1-21-5-13-25(14-6-21)29(33)37(30(34)26-15-7-22(2)8-16-26,31(35)27-17-9-23(3)10-18-27)32(36)28-19-11-24(4)12-20-28;1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h5-20H,1-4H3;1-20H/q+1;-1.
What are the key properties of tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide?
tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide has a molecular weight of 826.78 g/mol, XLogP of 10.66, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(4-methylbenzoyl)phosphanium;tetraphenylboranuide is sourced from PubChem (CID 22058921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).