About 4-(1-aminoethyl)phenol;hydrochloride
4-(1-aminoethyl)phenol;hydrochloride (PubChem CID 22058928) has the molecular formula C8H12ClNO
and a molecular weight of 173.64 g/mol. Its IUPAC name is 4-(1-aminoethyl)phenol;hydrochloride.
Molecular Properties
| Compound Name | 4-(1-aminoethyl)phenol;hydrochloride |
| PubChem CID | 22058928 |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 4-(1-aminoethyl)phenol;hydrochloride |
| SMILES | CC(N)c1ccc(O)cc1.Cl |
| InChI | InChI=1S/C8H11NO.ClH/c1-6(9)7-2-4-8(10)5-3-7;/h2-6,10H,9H2,1H3;1H |
| InChIKey | HNDFWZASJWHBCZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.64 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1-aminoethyl)phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-aminoethyl)phenol;hydrochloride?
The IUPAC name of 4-(1-aminoethyl)phenol;hydrochloride (CID 22058928) is 4-(1-aminoethyl)phenol;hydrochloride.
What is the SMILES notation for 4-(1-aminoethyl)phenol;hydrochloride?
The canonical SMILES for 4-(1-aminoethyl)phenol;hydrochloride is CC(N)c1ccc(O)cc1.Cl.
What is the InChIKey of 4-(1-aminoethyl)phenol;hydrochloride?
The InChIKey is HNDFWZASJWHBCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.ClH/c1-6(9)7-2-4-8(10)5-3-7;/h2-6,10H,9H2,1H3;1H.
What are the key properties of 4-(1-aminoethyl)phenol;hydrochloride?
4-(1-aminoethyl)phenol;hydrochloride has a molecular weight of 173.64 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-aminoethyl)phenol;hydrochloride is sourced from PubChem (CID 22058928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).