About (5-acetyl-6-oxoheptyl) acetate
(5-acetyl-6-oxoheptyl) acetate (PubChem CID 22059790) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is (5-acetyl-6-oxoheptyl) acetate.
Molecular Properties
| Compound Name | (5-acetyl-6-oxoheptyl) acetate |
| PubChem CID | 22059790 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (5-acetyl-6-oxoheptyl) acetate |
| SMILES | CC(=O)OCCCCC(C(C)=O)C(C)=O |
| InChI | InChI=1S/C11H18O4/c1-8(12)11(9(2)13)6-4-5-7-15-10(3)14/h11H,4-7H2,1-3H3 |
| InChIKey | CBAQHQRSUAOXRW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (5-acetyl-6-oxoheptyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-acetyl-6-oxoheptyl) acetate?
The IUPAC name of (5-acetyl-6-oxoheptyl) acetate (CID 22059790) is (5-acetyl-6-oxoheptyl) acetate.
What is the SMILES notation for (5-acetyl-6-oxoheptyl) acetate?
The canonical SMILES for (5-acetyl-6-oxoheptyl) acetate is CC(=O)OCCCCC(C(C)=O)C(C)=O.
What is the InChIKey of (5-acetyl-6-oxoheptyl) acetate?
The InChIKey is CBAQHQRSUAOXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-8(12)11(9(2)13)6-4-5-7-15-10(3)14/h11H,4-7H2,1-3H3.
What are the key properties of (5-acetyl-6-oxoheptyl) acetate?
(5-acetyl-6-oxoheptyl) acetate has a molecular weight of 214.26 g/mol, XLogP of 1.51, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-acetyl-6-oxoheptyl) acetate is sourced from PubChem (CID 22059790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).