C16H23N3O3 — CID 2206007
N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-N'-(2-methoxyphenyl)oxamide (PubChem CID 2206007) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-N'-(2-methoxyphenyl)oxamide.
| Compound Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-N'-(2-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 2206007 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-N'-(2-methoxyphenyl)oxamide |
| SMILES | CCN1CCC[C@@H]1CNC(=O)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C16H23N3O3/c1-3-19-10-6-7-12(19)11-17-15(20)16(21)18-13-8-4-5-9-14(13)22-2/h4-5,8-9,12H,3,6-7,10-11H2,1-2H3,(H,17,20)(H,18,21)/t12-/m1/s1 |
| InChIKey | ZGGPARUMGCQZFG-GFCCVEGCSA-N |
| XLogP | 1.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|