About 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine
4H-imidazo[2,1-c][1,4]benzoxazin-8-amine (PubChem CID 22060202) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine.
Molecular Properties
| Compound Name | 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine |
| PubChem CID | 22060202 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine |
| SMILES | Nc1ccc2c(c1)-n1ccnc1CO2 |
| InChI | InChI=1S/C10H9N3O/c11-7-1-2-9-8(5-7)13-4-3-12-10(13)6-14-9/h1-5H,6,11H2 |
| InChIKey | MEFVCVYICXFEEC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine?
The IUPAC name of 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine (CID 22060202) is 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine.
What is the SMILES notation for 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine?
The canonical SMILES for 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine is Nc1ccc2c(c1)-n1ccnc1CO2.
What is the InChIKey of 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine?
The InChIKey is MEFVCVYICXFEEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c11-7-1-2-9-8(5-7)13-4-3-12-10(13)6-14-9/h1-5H,6,11H2.
What are the key properties of 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine?
4H-imidazo[2,1-c][1,4]benzoxazin-8-amine has a molecular weight of 187.20 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-imidazo[2,1-c][1,4]benzoxazin-8-amine is sourced from PubChem (CID 22060202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).