About ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate
ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate (PubChem CID 22060274) has the molecular formula C23H22FN5O4
and a molecular weight of 451.46 g/mol. Its IUPAC name is ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate |
| PubChem CID | 22060274 |
| Molecular Formula | C23H22FN5O4 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cccc(Nc3ncc(F)c(Nc4cc(OC)cc(OC)c4)n3)c2[nH]1 |
| InChI | InChI=1S/C23H22FN5O4/c1-4-33-22(30)19-8-13-6-5-7-18(20(13)27-19)28-23-25-12-17(24)21(29-23)26-14-9-15(31-2)11-16(10-14)32-3/h5-12,27H,4H2,1-3H3,(H2,25,26,28,29) |
| InChIKey | UJJWAJUJTYPRGA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate?
The IUPAC name of ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate (CID 22060274) is ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate.
What is the SMILES notation for ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate?
The canonical SMILES for ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate is CCOC(=O)c1cc2cccc(Nc3ncc(F)c(Nc4cc(OC)cc(OC)c4)n3)c2[nH]1.
What is the InChIKey of ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate?
The InChIKey is UJJWAJUJTYPRGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22FN5O4/c1-4-33-22(30)19-8-13-6-5-7-18(20(13)27-19)28-23-25-12-17(24)21(29-23)26-14-9-15(31-2)11-16(10-14)32-3/h5-12,27H,4H2,1-3H3,(H2,25,26,28,29).
What are the key properties of ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate?
ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate has a molecular weight of 451.46 g/mol, XLogP of 4.78, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[[4-(3,5-dimethoxyanilino)-5-fluoropyrimidin-2-yl]amino]-1H-indole-2-carboxylate is sourced from PubChem (CID 22060274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).