About 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol
4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol (PubChem CID 22060325) has the molecular formula C19H15ClFN5O2
and a molecular weight of 399.81 g/mol. Its IUPAC name is 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol.
Molecular Properties
| Compound Name | 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol |
| PubChem CID | 22060325 |
| Molecular Formula | C19H15ClFN5O2 |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol |
| SMILES | Cc1cc(Nc2ncc(F)c(Nc3ccc4c(c3)NC=CO4)n2)cc(Cl)c1O |
| InChI | InChI=1S/C19H15ClFN5O2/c1-10-6-12(7-13(20)17(10)27)25-19-23-9-14(21)18(26-19)24-11-2-3-16-15(8-11)22-4-5-28-16/h2-9,22,27H,1H3,(H2,23,24,25,26) |
| InChIKey | CGQBPBMEEMFION-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 91.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol?
The IUPAC name of 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol (CID 22060325) is 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol.
What is the SMILES notation for 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol?
The canonical SMILES for 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol is Cc1cc(Nc2ncc(F)c(Nc3ccc4c(c3)NC=CO4)n2)cc(Cl)c1O.
What is the InChIKey of 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol?
The InChIKey is CGQBPBMEEMFION-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClFN5O2/c1-10-6-12(7-13(20)17(10)27)25-19-23-9-14(21)18(26-19)24-11-2-3-16-15(8-11)22-4-5-28-16/h2-9,22,27H,1H3,(H2,23,24,25,26).
What are the key properties of 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol?
4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol has a molecular weight of 399.81 g/mol, XLogP of 5.05, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(4H-1,4-benzoxazin-6-ylamino)-5-fluoropyrimidin-2-yl]amino]-2-chloro-6-methylphenol is sourced from PubChem (CID 22060325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).