C29H29FN6O2 — CID 22060340
2-N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoropyrimidine-2,4-diamine (PubChem CID 22060340) has the molecular formula C29H29FN6O2 and a molecular weight of 512.59 g/mol. Its IUPAC name is 2-N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22060340 |
| Molecular Formula | C29H29FN6O2 |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 2-N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoropyrimidine-2,4-diamine |
| SMILES | Fc1cnc(Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)nc1Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C29H29FN6O2/c30-25-19-31-29(34-28(25)32-23-8-11-26-27(18-23)38-17-16-37-26)33-22-6-9-24(10-7-22)36-14-12-35(13-15-36)20-21-4-2-1-3-5-21/h1-11,18-19H,12-17,20H2,(H2,31,32,33,34) |
| InChIKey | SPGPKFJDUGIPRG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|