About 4-amino-1,1-dioxo-1,2-benzothiazol-3-one
4-amino-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 22061190) has the molecular formula C7H6N2O3S
and a molecular weight of 198.20 g/mol. Its IUPAC name is 4-amino-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 4-amino-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 22061190 |
| Molecular Formula | C7H6N2O3S |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 4-amino-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | Nc1cccc2c1C(=O)NS2(=O)=O |
| InChI | InChI=1S/C7H6N2O3S/c8-4-2-1-3-5-6(4)7(10)9-13(5,11)12/h1-3H,8H2,(H,9,10) |
| InChIKey | JQSVXJNTPDVVKM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 4-amino-1,1-dioxo-1,2-benzothiazol-3-one (CID 22061190) is 4-amino-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 4-amino-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 4-amino-1,1-dioxo-1,2-benzothiazol-3-one is Nc1cccc2c1C(=O)NS2(=O)=O.
What is the InChIKey of 4-amino-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is JQSVXJNTPDVVKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O3S/c8-4-2-1-3-5-6(4)7(10)9-13(5,11)12/h1-3H,8H2,(H,9,10).
What are the key properties of 4-amino-1,1-dioxo-1,2-benzothiazol-3-one?
4-amino-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 198.20 g/mol, XLogP of -0.30, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 22061190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).