About 4-(4-aminophenyl)-2,3-diphenylaniline
4-(4-aminophenyl)-2,3-diphenylaniline (PubChem CID 22061811) has the molecular formula C24H20N2
and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,3-diphenylaniline.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)-2,3-diphenylaniline |
| PubChem CID | 22061811 |
| Molecular Formula | C24H20N2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-(4-aminophenyl)-2,3-diphenylaniline |
| SMILES | Nc1ccc(-c2ccc(N)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N2/c25-20-13-11-17(12-14-20)21-15-16-22(26)24(19-9-5-2-6-10-19)23(21)18-7-3-1-4-8-18/h1-16H,25-26H2 |
| InChIKey | PMVRHMKYOMJWSD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)-2,3-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)-2,3-diphenylaniline?
The IUPAC name of 4-(4-aminophenyl)-2,3-diphenylaniline (CID 22061811) is 4-(4-aminophenyl)-2,3-diphenylaniline.
What is the SMILES notation for 4-(4-aminophenyl)-2,3-diphenylaniline?
The canonical SMILES for 4-(4-aminophenyl)-2,3-diphenylaniline is Nc1ccc(-c2ccc(N)c(-c3ccccc3)c2-c2ccccc2)cc1.
What is the InChIKey of 4-(4-aminophenyl)-2,3-diphenylaniline?
The InChIKey is PMVRHMKYOMJWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2/c25-20-13-11-17(12-14-20)21-15-16-22(26)24(19-9-5-2-6-10-19)23(21)18-7-3-1-4-8-18/h1-16H,25-26H2.
What are the key properties of 4-(4-aminophenyl)-2,3-diphenylaniline?
4-(4-aminophenyl)-2,3-diphenylaniline has a molecular weight of 336.44 g/mol, XLogP of 5.85, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)-2,3-diphenylaniline is sourced from PubChem (CID 22061811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).