About 2-aminoethanol;4-methyl-2-nitroaniline
2-aminoethanol;4-methyl-2-nitroaniline (PubChem CID 22061887) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-aminoethanol;4-methyl-2-nitroaniline.
Molecular Properties
| Compound Name | 2-aminoethanol;4-methyl-2-nitroaniline |
| PubChem CID | 22061887 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2-aminoethanol;4-methyl-2-nitroaniline |
| SMILES | Cc1ccc(N)c([N+](=O)[O-])c1.NCCO |
| InChI | InChI=1S/C7H8N2O2.C2H7NO/c1-5-2-3-6(8)7(4-5)9(10)11;3-1-2-4/h2-4H,8H2,1H3;4H,1-3H2 |
| InChIKey | OKMRHFONZFOZMI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;4-methyl-2-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;4-methyl-2-nitroaniline?
The IUPAC name of 2-aminoethanol;4-methyl-2-nitroaniline (CID 22061887) is 2-aminoethanol;4-methyl-2-nitroaniline.
What is the SMILES notation for 2-aminoethanol;4-methyl-2-nitroaniline?
The canonical SMILES for 2-aminoethanol;4-methyl-2-nitroaniline is Cc1ccc(N)c([N+](=O)[O-])c1.NCCO.
What is the InChIKey of 2-aminoethanol;4-methyl-2-nitroaniline?
The InChIKey is OKMRHFONZFOZMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2.C2H7NO/c1-5-2-3-6(8)7(4-5)9(10)11;3-1-2-4/h2-4H,8H2,1H3;4H,1-3H2.
What are the key properties of 2-aminoethanol;4-methyl-2-nitroaniline?
2-aminoethanol;4-methyl-2-nitroaniline has a molecular weight of 213.24 g/mol, XLogP of 0.42, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;4-methyl-2-nitroaniline is sourced from PubChem (CID 22061887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).