About 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride
4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride (PubChem CID 22061900) has the molecular formula C12H14ClN3
and a molecular weight of 235.72 g/mol. Its IUPAC name is 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride |
| PubChem CID | 22061900 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc(-c2ccc(N)cc2N)cc1 |
| InChI | InChI=1S/C12H13N3.ClH/c13-9-3-1-8(2-4-9)11-6-5-10(14)7-12(11)15;/h1-7H,13-15H2;1H |
| InChIKey | UPWSUPQSYYDGED-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride?
The IUPAC name of 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride (CID 22061900) is 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride.
What is the SMILES notation for 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride?
The canonical SMILES for 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride is Cl.Nc1ccc(-c2ccc(N)cc2N)cc1.
What is the InChIKey of 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride?
The InChIKey is UPWSUPQSYYDGED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3.ClH/c13-9-3-1-8(2-4-9)11-6-5-10(14)7-12(11)15;/h1-7H,13-15H2;1H.
What are the key properties of 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride?
4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride has a molecular weight of 235.72 g/mol, XLogP of 2.52, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride is sourced from PubChem (CID 22061900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).