About 2-amino-4-(2,4-diaminophenyl)phenol
2-amino-4-(2,4-diaminophenyl)phenol (PubChem CID 22062032) has the molecular formula C12H13N3O
and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-amino-4-(2,4-diaminophenyl)phenol.
Molecular Properties
| Compound Name | 2-amino-4-(2,4-diaminophenyl)phenol |
| PubChem CID | 22062032 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-amino-4-(2,4-diaminophenyl)phenol |
| SMILES | Nc1ccc(-c2ccc(O)c(N)c2)c(N)c1 |
| InChI | InChI=1S/C12H13N3O/c13-8-2-3-9(10(14)6-8)7-1-4-12(16)11(15)5-7/h1-6,16H,13-15H2 |
| InChIKey | SSGWSXFSKXFFGS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(2,4-diaminophenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(2,4-diaminophenyl)phenol?
The IUPAC name of 2-amino-4-(2,4-diaminophenyl)phenol (CID 22062032) is 2-amino-4-(2,4-diaminophenyl)phenol.
What is the SMILES notation for 2-amino-4-(2,4-diaminophenyl)phenol?
The canonical SMILES for 2-amino-4-(2,4-diaminophenyl)phenol is Nc1ccc(-c2ccc(O)c(N)c2)c(N)c1.
What is the InChIKey of 2-amino-4-(2,4-diaminophenyl)phenol?
The InChIKey is SSGWSXFSKXFFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O/c13-8-2-3-9(10(14)6-8)7-1-4-12(16)11(15)5-7/h1-6,16H,13-15H2.
What are the key properties of 2-amino-4-(2,4-diaminophenyl)phenol?
2-amino-4-(2,4-diaminophenyl)phenol has a molecular weight of 215.26 g/mol, XLogP of 1.81, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(2,4-diaminophenyl)phenol is sourced from PubChem (CID 22062032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).