About [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate
[(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate (PubChem CID 22062187) has the molecular formula C9H11NO5S
and a molecular weight of 245.26 g/mol. Its IUPAC name is [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate.
Molecular Properties
| Compound Name | [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate |
| PubChem CID | 22062187 |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate |
| SMILES | COCC1=C/C(=N/OS(C)(=O)=O)C=CC1=O |
| InChI | InChI=1S/C9H11NO5S/c1-14-6-7-5-8(3-4-9(7)11)10-15-16(2,12)13/h3-5H,6H2,1-2H3/b10-8+ |
| InChIKey | RBEJUFGFBLPXLN-CSKARUKUSA-N |
| XLogP | 0.03 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate?
The IUPAC name of [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate (CID 22062187) is [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate.
What is the SMILES notation for [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate?
The canonical SMILES for [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate is COCC1=C/C(=N/OS(C)(=O)=O)C=CC1=O.
What is the InChIKey of [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate?
The InChIKey is RBEJUFGFBLPXLN-CSKARUKUSA-N. The full InChI is InChI=1S/C9H11NO5S/c1-14-6-7-5-8(3-4-9(7)11)10-15-16(2,12)13/h3-5H,6H2,1-2H3/b10-8+.
What are the key properties of [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate?
[(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate has a molecular weight of 245.26 g/mol, XLogP of 0.03, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[3-(methoxymethyl)-4-oxocyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate is sourced from PubChem (CID 22062187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).