About 1-methoxy-N,N-dimethylpropan-1-amine
1-methoxy-N,N-dimethylpropan-1-amine (PubChem CID 22062441) has the molecular formula C6H15NO
and a molecular weight of 117.19 g/mol. Its IUPAC name is 1-methoxy-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-methoxy-N,N-dimethylpropan-1-amine |
| PubChem CID | 22062441 |
| Molecular Formula | C6H15NO |
| Molecular Weight | 117.19 g/mol |
| Exact Mass | 117.12 |
| IUPAC Name | 1-methoxy-N,N-dimethylpropan-1-amine |
| SMILES | CCC(OC)N(C)C |
| InChI | InChI=1S/C6H15NO/c1-5-6(8-4)7(2)3/h6H,5H2,1-4H3 |
| InChIKey | MCAWHDASPIOXKO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-N,N-dimethylpropan-1-amine?
The IUPAC name of 1-methoxy-N,N-dimethylpropan-1-amine (CID 22062441) is 1-methoxy-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 1-methoxy-N,N-dimethylpropan-1-amine?
The canonical SMILES for 1-methoxy-N,N-dimethylpropan-1-amine is CCC(OC)N(C)C.
What is the InChIKey of 1-methoxy-N,N-dimethylpropan-1-amine?
The InChIKey is MCAWHDASPIOXKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO/c1-5-6(8-4)7(2)3/h6H,5H2,1-4H3.
What are the key properties of 1-methoxy-N,N-dimethylpropan-1-amine?
1-methoxy-N,N-dimethylpropan-1-amine has a molecular weight of 117.19 g/mol, XLogP of 0.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 22062441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).