C15H12Cl3NO5S — CID 2206278
methyl 2-[2-chloro-4-[(3,4-dichlorophenyl)sulfamoyl]phenoxy]acetate (PubChem CID 2206278) has the molecular formula C15H12Cl3NO5S and a molecular weight of 424.69 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-[(3,4-dichlorophenyl)sulfamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-chloro-4-[(3,4-dichlorophenyl)sulfamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2206278 |
| Molecular Formula | C15H12Cl3NO5S |
| Molecular Weight | 424.69 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | methyl 2-[2-chloro-4-[(3,4-dichlorophenyl)sulfamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(S(=O)(=O)Nc2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C15H12Cl3NO5S/c1-23-15(20)8-24-14-5-3-10(7-13(14)18)25(21,22)19-9-2-4-11(16)12(17)6-9/h2-7,19H,8H2,1H3 |
| InChIKey | QDKZOKLBTINDOU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.69 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |