About thiophene-2-carboxamide
thiophene-2-carboxamide (PubChem CID 22063) has the molecular formula C5H5NOS
and a molecular weight of 127.17 g/mol. Its IUPAC name is thiophene-2-carboxamide.
Molecular Properties
| Compound Name | thiophene-2-carboxamide |
| PubChem CID | 22063 |
| Molecular Formula | C5H5NOS |
| Molecular Weight | 127.17 g/mol |
| Exact Mass | 127.01 |
| IUPAC Name | thiophene-2-carboxamide |
| SMILES | NC(=O)c1cccs1 |
| InChI | InChI=1S/C5H5NOS/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7) |
| InChIKey | DENPQNAWGQXKCU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene-2-carboxamide?
The IUPAC name of thiophene-2-carboxamide (CID 22063) is thiophene-2-carboxamide.
What is the SMILES notation for thiophene-2-carboxamide?
The canonical SMILES for thiophene-2-carboxamide is NC(=O)c1cccs1.
What is the InChIKey of thiophene-2-carboxamide?
The InChIKey is DENPQNAWGQXKCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NOS/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7).
What are the key properties of thiophene-2-carboxamide?
thiophene-2-carboxamide has a molecular weight of 127.17 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-2-carboxamide is sourced from PubChem (CID 22063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).