About N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide
N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide (PubChem CID 22063099) has the molecular formula C16H28N4O2
and a molecular weight of 308.43 g/mol. Its IUPAC name is N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide.
Molecular Properties
| Compound Name | N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide |
| PubChem CID | 22063099 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide |
| SMILES | CC(C)N1CCC(C#N)(NC(=O)CCC(C)(C)C(N)=O)CC1 |
| InChI | InChI=1S/C16H28N4O2/c1-12(2)20-9-7-16(11-17,8-10-20)19-13(21)5-6-15(3,4)14(18)22/h12H,5-10H2,1-4H3,(H2,18,22)(H,19,21) |
| InChIKey | MSCSKBDPVDXCDG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide?
The IUPAC name of N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide (CID 22063099) is N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide.
What is the SMILES notation for N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide?
The canonical SMILES for N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide is CC(C)N1CCC(C#N)(NC(=O)CCC(C)(C)C(N)=O)CC1.
What is the InChIKey of N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide?
The InChIKey is MSCSKBDPVDXCDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4O2/c1-12(2)20-9-7-16(11-17,8-10-20)19-13(21)5-6-15(3,4)14(18)22/h12H,5-10H2,1-4H3,(H2,18,22)(H,19,21).
What are the key properties of N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide?
N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide has a molecular weight of 308.43 g/mol, XLogP of 1.16, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-cyano-1-propan-2-ylpiperidin-4-yl)-2,2-dimethylpentanediamide is sourced from PubChem (CID 22063099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).