C28H29NO6 — CID 22064511
(5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-6-yl) butanoate (PubChem CID 22064511) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is (5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-6-yl) butanoate.
| Compound Name | (5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-6-yl) butanoate |
|---|---|
| PubChem CID | 22064511 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | (5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-6-yl) butanoate |
| SMILES | CCCC(=O)OC1C(O)c2c(cc(OC)c3c(=O)c4cc5ccccc5cc4n(C)c23)OC1(C)C |
| InChI | InChI=1S/C28H29NO6/c1-6-9-21(30)34-27-26(32)23-20(35-28(27,2)3)14-19(33-5)22-24(23)29(4)18-13-16-11-8-7-10-15(16)12-17(18)25(22)31/h7-8,10-14,26-27,32H,6,9H2,1-5H3 |
| InChIKey | LGMFSDGDFKMBNN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|