C34H35NO7 — CID 22064532
[11-methoxy-2,7,7-trimethyl-13-oxo-6-[(E)-pent-2-enoyl]oxy-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-5-yl] (E)-pent-2-enoate (PubChem CID 22064532) has the molecular formula C34H35NO7 and a molecular weight of 569.65 g/mol. Its IUPAC name is [11-methoxy-2,7,7-trimethyl-13-oxo-6-[(E)-pent-2-enoyl]oxy-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-5-yl] (E)-pent-2-enoate.
| Compound Name | [11-methoxy-2,7,7-trimethyl-13-oxo-6-[(E)-pent-2-enoyl]oxy-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-5-yl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 22064532 |
| Molecular Formula | C34H35NO7 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | [11-methoxy-2,7,7-trimethyl-13-oxo-6-[(E)-pent-2-enoyl]oxy-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-5-yl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OC1c2c(cc(OC)c3c(=O)c4cc5ccccc5cc4n(C)c23)OC(C)(C)C1OC(=O)/C=C/CC |
| InChI | InChI=1S/C34H35NO7/c1-7-9-15-26(36)40-32-29-25(42-34(3,4)33(32)41-27(37)16-10-8-2)19-24(39-6)28-30(29)35(5)23-18-21-14-12-11-13-20(21)17-22(23)31(28)38/h9-19,32-33H,7-8H2,1-6H3/b15-9+,16-10+ |
| InChIKey | XIKSTUKILQPZBB-KAVGSWPWSA-N |
| XLogP | 6.45 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|