About 6-(aminomethyl)-1,2-benzoxazol-3-amine
6-(aminomethyl)-1,2-benzoxazol-3-amine (PubChem CID 22064731) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 6-(aminomethyl)-1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | 6-(aminomethyl)-1,2-benzoxazol-3-amine |
| PubChem CID | 22064731 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 6-(aminomethyl)-1,2-benzoxazol-3-amine |
| SMILES | NCc1ccc2c(N)noc2c1 |
| InChI | InChI=1S/C8H9N3O/c9-4-5-1-2-6-7(3-5)12-11-8(6)10/h1-3H,4,9H2,(H2,10,11) |
| InChIKey | GHYKJSGZYRADNG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(aminomethyl)-1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-1,2-benzoxazol-3-amine?
The IUPAC name of 6-(aminomethyl)-1,2-benzoxazol-3-amine (CID 22064731) is 6-(aminomethyl)-1,2-benzoxazol-3-amine.
What is the SMILES notation for 6-(aminomethyl)-1,2-benzoxazol-3-amine?
The canonical SMILES for 6-(aminomethyl)-1,2-benzoxazol-3-amine is NCc1ccc2c(N)noc2c1.
What is the InChIKey of 6-(aminomethyl)-1,2-benzoxazol-3-amine?
The InChIKey is GHYKJSGZYRADNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c9-4-5-1-2-6-7(3-5)12-11-8(6)10/h1-3H,4,9H2,(H2,10,11).
What are the key properties of 6-(aminomethyl)-1,2-benzoxazol-3-amine?
6-(aminomethyl)-1,2-benzoxazol-3-amine has a molecular weight of 163.18 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-1,2-benzoxazol-3-amine is sourced from PubChem (CID 22064731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).