C26H25ClF2N4O4S — CID 22065073
N-[2-(4-aminophenyl)ethyl]-2-[1-(4-chloro-2,5-dimethylphenyl)sulfonyl-6,7-difluoro-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide (PubChem CID 22065073) has the molecular formula C26H25ClF2N4O4S and a molecular weight of 563.03 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-[1-(4-chloro-2,5-dimethylphenyl)sulfonyl-6,7-difluoro-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-[1-(4-chloro-2,5-dimethylphenyl)sulfonyl-6,7-difluoro-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 22065073 |
| Molecular Formula | C26H25ClF2N4O4S |
| Molecular Weight | 563.03 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-[1-(4-chloro-2,5-dimethylphenyl)sulfonyl-6,7-difluoro-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
| SMILES | Cc1cc(S(=O)(=O)N2c3cc(F)c(F)cc3NC(=O)C2CC(=O)NCCc2ccc(N)cc2)c(C)cc1Cl |
| InChI | InChI=1S/C26H25ClF2N4O4S/c1-14-10-24(15(2)9-18(14)27)38(36,37)33-22-12-20(29)19(28)11-21(22)32-26(35)23(33)13-25(34)31-8-7-16-3-5-17(30)6-4-16/h3-6,9-12,23H,7-8,13,30H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | DKEFJBGYZOOMKH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.03 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|