About 4-phenylcyclohexa-1,5-diene-1,4-diol
4-phenylcyclohexa-1,5-diene-1,4-diol (PubChem CID 22065259) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-phenylcyclohexa-1,5-diene-1,4-diol.
Molecular Properties
| Compound Name | 4-phenylcyclohexa-1,5-diene-1,4-diol |
| PubChem CID | 22065259 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4-phenylcyclohexa-1,5-diene-1,4-diol |
| SMILES | OC1=CCC(O)(c2ccccc2)C=C1 |
| InChI | InChI=1S/C12H12O2/c13-11-6-8-12(14,9-7-11)10-4-2-1-3-5-10/h1-8,13-14H,9H2 |
| InChIKey | UVEUVUQAVQTZTB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenylcyclohexa-1,5-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylcyclohexa-1,5-diene-1,4-diol?
The IUPAC name of 4-phenylcyclohexa-1,5-diene-1,4-diol (CID 22065259) is 4-phenylcyclohexa-1,5-diene-1,4-diol.
What is the SMILES notation for 4-phenylcyclohexa-1,5-diene-1,4-diol?
The canonical SMILES for 4-phenylcyclohexa-1,5-diene-1,4-diol is OC1=CCC(O)(c2ccccc2)C=C1.
What is the InChIKey of 4-phenylcyclohexa-1,5-diene-1,4-diol?
The InChIKey is UVEUVUQAVQTZTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c13-11-6-8-12(14,9-7-11)10-4-2-1-3-5-10/h1-8,13-14H,9H2.
What are the key properties of 4-phenylcyclohexa-1,5-diene-1,4-diol?
4-phenylcyclohexa-1,5-diene-1,4-diol has a molecular weight of 188.23 g/mol, XLogP of 2.28, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylcyclohexa-1,5-diene-1,4-diol is sourced from PubChem (CID 22065259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).