C13H6F8N2O — CID 22065346
3-(2,2,3,3,4,4,5,5-octafluoropentoxy)benzene-1,2-dicarbonitrile (PubChem CID 22065346) has the molecular formula C13H6F8N2O and a molecular weight of 358.19 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,5,5-octafluoropentoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 3-(2,2,3,3,4,4,5,5-octafluoropentoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 22065346 |
| Molecular Formula | C13H6F8N2O |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 3-(2,2,3,3,4,4,5,5-octafluoropentoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)c1C#N |
| InChI | InChI=1S/C13H6F8N2O/c14-10(15)12(18,19)13(20,21)11(16,17)6-24-9-3-1-2-7(4-22)8(9)5-23/h1-3,10H,6H2 |
| InChIKey | RWJHFNCFGGHJSQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|