C31H44B2O4 — CID 22065817
2-[9,9-dipropyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 22065817) has the molecular formula C31H44B2O4 and a molecular weight of 502.31 g/mol. Its IUPAC name is 2-[9,9-dipropyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[9,9-dipropyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 22065817 |
| Molecular Formula | C31H44B2O4 |
| Molecular Weight | 502.31 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | 2-[9,9-dipropyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCC1(CCC)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C31H44B2O4/c1-11-17-31(18-12-2)25-19-21(32-34-27(3,4)28(5,6)35-32)13-15-23(25)24-16-14-22(20-26(24)31)33-36-29(7,8)30(9,10)37-33/h13-16,19-20H,11-12,17-18H2,1-10H3 |
| InChIKey | IWSBWAJTWSOOAG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.31 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|