About 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane
2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 22065964) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 22065964 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | c1ccc(N2CC3CC2CN3)nc1 |
| InChI | InChI=1S/C10H13N3/c1-2-4-11-10(3-1)13-7-8-5-9(13)6-12-8/h1-4,8-9,12H,5-7H2 |
| InChIKey | SXPJIQKJNBPVON-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane (CID 22065964) is 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane is c1ccc(N2CC3CC2CN3)nc1.
What is the InChIKey of 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is SXPJIQKJNBPVON-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-2-4-11-10(3-1)13-7-8-5-9(13)6-12-8/h1-4,8-9,12H,5-7H2.
What are the key properties of 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane?
2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 175.24 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 22065964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).